C35H21Cl2N5OS — CID 18871290
3-benzhydryl-6-[2-[5-(2,4-dichlorophenyl)furan-2-yl]quinolin-4-yl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 18871290) has the molecular formula C35H21Cl2N5OS and a molecular weight of 630.56 g/mol. Its IUPAC name is 3-benzhydryl-6-[2-[5-(2,4-dichlorophenyl)furan-2-yl]quinolin-4-yl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 3-benzhydryl-6-[2-[5-(2,4-dichlorophenyl)furan-2-yl]quinolin-4-yl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 18871290 |
| Molecular Formula | C35H21Cl2N5OS |
| Molecular Weight | 630.56 g/mol |
| Exact Mass | 629.08 |
| IUPAC Name | 3-benzhydryl-6-[2-[5-(2,4-dichlorophenyl)furan-2-yl]quinolin-4-yl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | Clc1ccc(-c2ccc(-c3cc(-c4nn5c(C(c6ccccc6)c6ccccc6)nnc5s4)c4ccccc4n3)o2)c(Cl)c1 |
| InChI | InChI=1S/C35H21Cl2N5OS/c36-23-15-16-25(27(37)19-23)30-17-18-31(43-30)29-20-26(24-13-7-8-14-28(24)38-29)34-41-42-33(39-40-35(42)44-34)32(21-9-3-1-4-10-21)22-11-5-2-6-12-22/h1-20,32H |
| InChIKey | YTVRKSYBSPAPJB-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 69.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.56 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |