About 2-(5-chloro-4,6-dimethyl-1-benzofuran-3-yl)-N-(3-methylphenyl)acetamide
2-(5-chloro-4,6-dimethyl-1-benzofuran-3-yl)-N-(3-methylphenyl)acetamide (PubChem CID 18872199) has the molecular formula C19H18ClNO2
and a molecular weight of 327.81 g/mol. Its IUPAC name is 2-(5-chloro-4,6-dimethyl-1-benzofuran-3-yl)-N-(3-methylphenyl)acetamide.
Molecular Properties
| Compound Name | 2-(5-chloro-4,6-dimethyl-1-benzofuran-3-yl)-N-(3-methylphenyl)acetamide |
| PubChem CID | 18872199 |
| Molecular Formula | C19H18ClNO2 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 2-(5-chloro-4,6-dimethyl-1-benzofuran-3-yl)-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)Cc2coc3cc(C)c(Cl)c(C)c23)c1 |
| InChI | InChI=1S/C19H18ClNO2/c1-11-5-4-6-15(7-11)21-17(22)9-14-10-23-16-8-12(2)19(20)13(3)18(14)16/h4-8,10H,9H2,1-3H3,(H,21,22) |
| InChIKey | JJYJYUBNIHHOGJ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(5-chloro-4,6-dimethyl-1-benzofuran-3-yl)-N-(3-methylphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-chloro-4,6-dimethyl-1-benzofuran-3-yl)-N-(3-methylphenyl)acetamide?
The IUPAC name of 2-(5-chloro-4,6-dimethyl-1-benzofuran-3-yl)-N-(3-methylphenyl)acetamide (CID 18872199) is 2-(5-chloro-4,6-dimethyl-1-benzofuran-3-yl)-N-(3-methylphenyl)acetamide.
What is the SMILES notation for 2-(5-chloro-4,6-dimethyl-1-benzofuran-3-yl)-N-(3-methylphenyl)acetamide?
The canonical SMILES for 2-(5-chloro-4,6-dimethyl-1-benzofuran-3-yl)-N-(3-methylphenyl)acetamide is Cc1cccc(NC(=O)Cc2coc3cc(C)c(Cl)c(C)c23)c1.
What is the InChIKey of 2-(5-chloro-4,6-dimethyl-1-benzofuran-3-yl)-N-(3-methylphenyl)acetamide?
The InChIKey is JJYJYUBNIHHOGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18ClNO2/c1-11-5-4-6-15(7-11)21-17(22)9-14-10-23-16-8-12(2)19(20)13(3)18(14)16/h4-8,10H,9H2,1-3H3,(H,21,22).
What are the key properties of 2-(5-chloro-4,6-dimethyl-1-benzofuran-3-yl)-N-(3-methylphenyl)acetamide?
2-(5-chloro-4,6-dimethyl-1-benzofuran-3-yl)-N-(3-methylphenyl)acetamide has a molecular weight of 327.81 g/mol, XLogP of 5.19, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-chloro-4,6-dimethyl-1-benzofuran-3-yl)-N-(3-methylphenyl)acetamide is sourced from PubChem (CID 18872199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).