C12H13NO2 — CID 18872501
2-(5-ethyl-1-benzofuran-3-yl)acetamide (PubChem CID 18872501) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is 2-(5-ethyl-1-benzofuran-3-yl)acetamide.
| Compound Name | 2-(5-ethyl-1-benzofuran-3-yl)acetamide |
|---|---|
| PubChem CID | 18872501 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 2-(5-ethyl-1-benzofuran-3-yl)acetamide |
| SMILES | CCc1ccc2occ(CC(N)=O)c2c1 |
| InChI | InChI=1S/C12H13NO2/c1-2-8-3-4-11-10(5-8)9(7-15-11)6-12(13)14/h3-5,7H,2,6H2,1H3,(H2,13,14) |
| InChIKey | RSDWXZPWWJDKIE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |