C22H22N2O5 — CID 18873799
methyl 4-[[6-[(4-hydroxyphenyl)carbamoyl]cyclohex-3-ene-1-carbonyl]amino]benzoate (PubChem CID 18873799) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is methyl 4-[[6-[(4-hydroxyphenyl)carbamoyl]cyclohex-3-ene-1-carbonyl]amino]benzoate.
| Compound Name | methyl 4-[[6-[(4-hydroxyphenyl)carbamoyl]cyclohex-3-ene-1-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 18873799 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | methyl 4-[[6-[(4-hydroxyphenyl)carbamoyl]cyclohex-3-ene-1-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C2CC=CCC2C(=O)Nc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C22H22N2O5/c1-29-22(28)14-6-8-15(9-7-14)23-20(26)18-4-2-3-5-19(18)21(27)24-16-10-12-17(25)13-11-16/h2-3,6-13,18-19,25H,4-5H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | VOJBUMUKKKYPJH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|