C21H23N5OS — CID 18874581
3-(4-butoxyphenyl)-N-(4-ethylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-amine (PubChem CID 18874581) has the molecular formula C21H23N5OS and a molecular weight of 393.52 g/mol. Its IUPAC name is 3-(4-butoxyphenyl)-N-(4-ethylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-amine.
| Compound Name | 3-(4-butoxyphenyl)-N-(4-ethylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-amine |
|---|---|
| PubChem CID | 18874581 |
| Molecular Formula | C21H23N5OS |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 3-(4-butoxyphenyl)-N-(4-ethylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-amine |
| SMILES | CCCCOc1ccc(-c2nnc3sc(Nc4ccc(CC)cc4)nn23)cc1 |
| InChI | InChI=1S/C21H23N5OS/c1-3-5-14-27-18-12-8-16(9-13-18)19-23-24-21-26(19)25-20(28-21)22-17-10-6-15(4-2)7-11-17/h6-13H,3-5,14H2,1-2H3,(H,22,25) |
| InChIKey | UBYFLDDTILSCSV-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 64.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|