About 5-[3,6-bis(4-methylphenyl)pyridazin-4-yl]-3-(4-chlorophenyl)-2,1-benzoxazole
5-[3,6-bis(4-methylphenyl)pyridazin-4-yl]-3-(4-chlorophenyl)-2,1-benzoxazole (PubChem CID 18874666) has the molecular formula C31H22ClN3O
and a molecular weight of 487.99 g/mol. Its IUPAC name is 5-[3,6-bis(4-methylphenyl)pyridazin-4-yl]-3-(4-chlorophenyl)-2,1-benzoxazole.
Molecular Properties
| Compound Name | 5-[3,6-bis(4-methylphenyl)pyridazin-4-yl]-3-(4-chlorophenyl)-2,1-benzoxazole |
| PubChem CID | 18874666 |
| Molecular Formula | C31H22ClN3O |
| Molecular Weight | 487.99 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | 5-[3,6-bis(4-methylphenyl)pyridazin-4-yl]-3-(4-chlorophenyl)-2,1-benzoxazole |
| SMILES | Cc1ccc(-c2cc(-c3ccc4noc(-c5ccc(Cl)cc5)c4c3)c(-c3ccc(C)cc3)nn2)cc1 |
| InChI | InChI=1S/C31H22ClN3O/c1-19-3-7-21(8-4-19)29-18-26(30(34-33-29)22-9-5-20(2)6-10-22)24-13-16-28-27(17-24)31(36-35-28)23-11-14-25(32)15-12-23/h3-18H,1-2H3 |
| InChIKey | YWVHIIKILVWEHZ-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 487.99 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[3,6-bis(4-methylphenyl)pyridazin-4-yl]-3-(4-chlorophenyl)-2,1-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3,6-bis(4-methylphenyl)pyridazin-4-yl]-3-(4-chlorophenyl)-2,1-benzoxazole?
The IUPAC name of 5-[3,6-bis(4-methylphenyl)pyridazin-4-yl]-3-(4-chlorophenyl)-2,1-benzoxazole (CID 18874666) is 5-[3,6-bis(4-methylphenyl)pyridazin-4-yl]-3-(4-chlorophenyl)-2,1-benzoxazole.
What is the SMILES notation for 5-[3,6-bis(4-methylphenyl)pyridazin-4-yl]-3-(4-chlorophenyl)-2,1-benzoxazole?
The canonical SMILES for 5-[3,6-bis(4-methylphenyl)pyridazin-4-yl]-3-(4-chlorophenyl)-2,1-benzoxazole is Cc1ccc(-c2cc(-c3ccc4noc(-c5ccc(Cl)cc5)c4c3)c(-c3ccc(C)cc3)nn2)cc1.
What is the InChIKey of 5-[3,6-bis(4-methylphenyl)pyridazin-4-yl]-3-(4-chlorophenyl)-2,1-benzoxazole?
The InChIKey is YWVHIIKILVWEHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H22ClN3O/c1-19-3-7-21(8-4-19)29-18-26(30(34-33-29)22-9-5-20(2)6-10-22)24-13-16-28-27(17-24)31(36-35-28)23-11-14-25(32)15-12-23/h3-18H,1-2H3.
What are the key properties of 5-[3,6-bis(4-methylphenyl)pyridazin-4-yl]-3-(4-chlorophenyl)-2,1-benzoxazole?
5-[3,6-bis(4-methylphenyl)pyridazin-4-yl]-3-(4-chlorophenyl)-2,1-benzoxazole has a molecular weight of 487.99 g/mol, XLogP of 8.56, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3,6-bis(4-methylphenyl)pyridazin-4-yl]-3-(4-chlorophenyl)-2,1-benzoxazole is sourced from PubChem (CID 18874666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).