C17H19N3O2S — CID 18874975
(2Z)-2-cyano-2-[3-(3,4-dimethylphenyl)-5-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]-N-methylacetamide (PubChem CID 18874975) has the molecular formula C17H19N3O2S and a molecular weight of 329.43 g/mol. Its IUPAC name is (2Z)-2-cyano-2-[3-(3,4-dimethylphenyl)-5-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]-N-methylacetamide.
| Compound Name | (2Z)-2-cyano-2-[3-(3,4-dimethylphenyl)-5-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]-N-methylacetamide |
|---|---|
| PubChem CID | 18874975 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | (2Z)-2-cyano-2-[3-(3,4-dimethylphenyl)-5-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]-N-methylacetamide |
| SMILES | CCC1S/C(=C(/C#N)C(=O)NC)N(c2ccc(C)c(C)c2)C1=O |
| InChI | InChI=1S/C17H19N3O2S/c1-5-14-16(22)20(12-7-6-10(2)11(3)8-12)17(23-14)13(9-18)15(21)19-4/h6-8,14H,5H2,1-4H3,(H,19,21)/b17-13- |
| InChIKey | DOPMCQDYJRERRZ-LGMDPLHJSA-N |
| XLogP | 2.64 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|