C25H21ClF3N3O2S — CID 18875132
(2Z)-2-[5-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]-3-(4-ethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-prop-2-enylacetamide (PubChem CID 18875132) has the molecular formula C25H21ClF3N3O2S and a molecular weight of 519.98 g/mol. Its IUPAC name is (2Z)-2-[5-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]-3-(4-ethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-prop-2-enylacetamide.
| Compound Name | (2Z)-2-[5-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]-3-(4-ethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 18875132 |
| Molecular Formula | C25H21ClF3N3O2S |
| Molecular Weight | 519.98 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | (2Z)-2-[5-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]-3-(4-ethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-2-cyano-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)/C(C#N)=C1\SC(Cc2cc(C(F)(F)F)ccc2Cl)C(=O)N1c1ccc(CC)cc1 |
| InChI | InChI=1S/C25H21ClF3N3O2S/c1-3-11-31-22(33)19(14-30)24-32(18-8-5-15(4-2)6-9-18)23(34)21(35-24)13-16-12-17(25(27,28)29)7-10-20(16)26/h3,5-10,12,21H,1,4,11,13H2,2H3,(H,31,33)/b24-19- |
| InChIKey | XMCVMSPKOCYPJA-CLCOLTQESA-N |
| XLogP | 5.65 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.98 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|