C24H21Cl2N3O2S — CID 18875221
(2Z)-2-cyano-2-[5-[(2,3-dichlorophenyl)methyl]-3-(3,4-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-N-prop-2-enylacetamide (PubChem CID 18875221) has the molecular formula C24H21Cl2N3O2S and a molecular weight of 486.42 g/mol. Its IUPAC name is (2Z)-2-cyano-2-[5-[(2,3-dichlorophenyl)methyl]-3-(3,4-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-N-prop-2-enylacetamide.
| Compound Name | (2Z)-2-cyano-2-[5-[(2,3-dichlorophenyl)methyl]-3-(3,4-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 18875221 |
| Molecular Formula | C24H21Cl2N3O2S |
| Molecular Weight | 486.42 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | (2Z)-2-cyano-2-[5-[(2,3-dichlorophenyl)methyl]-3-(3,4-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)/C(C#N)=C1\SC(Cc2cccc(Cl)c2Cl)C(=O)N1c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C24H21Cl2N3O2S/c1-4-10-28-22(30)18(13-27)24-29(17-9-8-14(2)15(3)11-17)23(31)20(32-24)12-16-6-5-7-19(25)21(16)26/h4-9,11,20H,1,10,12H2,2-3H3,(H,28,30)/b24-18- |
| InChIKey | VUPQKJXORQOMEI-MOHJPFBDSA-N |
| XLogP | 5.34 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.42 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|