C29H25Cl2N3O2S — CID 18875451
(2Z)-2-cyano-2-[5-[(3,5-dichlorophenyl)methyl]-3-(3,4-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-N-(1-phenylethyl)acetamide (PubChem CID 18875451) has the molecular formula C29H25Cl2N3O2S and a molecular weight of 550.51 g/mol. Its IUPAC name is (2Z)-2-cyano-2-[5-[(3,5-dichlorophenyl)methyl]-3-(3,4-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-N-(1-phenylethyl)acetamide.
| Compound Name | (2Z)-2-cyano-2-[5-[(3,5-dichlorophenyl)methyl]-3-(3,4-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-N-(1-phenylethyl)acetamide |
|---|---|
| PubChem CID | 18875451 |
| Molecular Formula | C29H25Cl2N3O2S |
| Molecular Weight | 550.51 g/mol |
| Exact Mass | 549.10 |
| IUPAC Name | (2Z)-2-cyano-2-[5-[(3,5-dichlorophenyl)methyl]-3-(3,4-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-N-(1-phenylethyl)acetamide |
| SMILES | Cc1ccc(N2C(=O)C(Cc3cc(Cl)cc(Cl)c3)S/C2=C(/C#N)C(=O)NC(C)c2ccccc2)cc1C |
| InChI | InChI=1S/C29H25Cl2N3O2S/c1-17-9-10-24(11-18(17)2)34-28(36)26(14-20-12-22(30)15-23(31)13-20)37-29(34)25(16-32)27(35)33-19(3)21-7-5-4-6-8-21/h4-13,15,19,26H,14H2,1-3H3,(H,33,35)/b29-25- |
| InChIKey | DPORNIZGLHNIBH-GNVQSUKOSA-N |
| XLogP | 6.91 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.51 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|