C21H22N2OS — CID 18876296
4-ethyl-N-[5-[(4-ethylphenyl)methyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 18876296) has the molecular formula C21H22N2OS and a molecular weight of 350.49 g/mol. Its IUPAC name is 4-ethyl-N-[5-[(4-ethylphenyl)methyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-ethyl-N-[5-[(4-ethylphenyl)methyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 18876296 |
| Molecular Formula | C21H22N2OS |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 4-ethyl-N-[5-[(4-ethylphenyl)methyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | CCc1ccc(Cc2cnc(NC(=O)c3ccc(CC)cc3)s2)cc1 |
| InChI | InChI=1S/C21H22N2OS/c1-3-15-5-7-17(8-6-15)13-19-14-22-21(25-19)23-20(24)18-11-9-16(4-2)10-12-18/h5-12,14H,3-4,13H2,1-2H3,(H,22,23,24) |
| InChIKey | BDRHTGLBQPDGPO-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |