C24H23ClN2S — CID 18878257
2-[(4-chlorophenyl)sulfanylmethyl]-1-[(4-propan-2-ylphenyl)methyl]benzimidazole (PubChem CID 18878257) has the molecular formula C24H23ClN2S and a molecular weight of 406.98 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfanylmethyl]-1-[(4-propan-2-ylphenyl)methyl]benzimidazole.
| Compound Name | 2-[(4-chlorophenyl)sulfanylmethyl]-1-[(4-propan-2-ylphenyl)methyl]benzimidazole |
|---|---|
| PubChem CID | 18878257 |
| Molecular Formula | C24H23ClN2S |
| Molecular Weight | 406.98 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfanylmethyl]-1-[(4-propan-2-ylphenyl)methyl]benzimidazole |
| SMILES | CC(C)c1ccc(Cn2c(CSc3ccc(Cl)cc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C24H23ClN2S/c1-17(2)19-9-7-18(8-10-19)15-27-23-6-4-3-5-22(23)26-24(27)16-28-21-13-11-20(25)12-14-21/h3-14,17H,15-16H2,1-2H3 |
| InChIKey | VLXNCLWHYPBCSI-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.98 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |