C18H14Cl2N2 — CID 18878893
2-[(E)-2-(2,6-dichlorophenyl)ethenyl]-1-prop-2-enylbenzimidazole (PubChem CID 18878893) has the molecular formula C18H14Cl2N2 and a molecular weight of 329.23 g/mol. Its IUPAC name is 2-[(E)-2-(2,6-dichlorophenyl)ethenyl]-1-prop-2-enylbenzimidazole.
| Compound Name | 2-[(E)-2-(2,6-dichlorophenyl)ethenyl]-1-prop-2-enylbenzimidazole |
|---|---|
| PubChem CID | 18878893 |
| Molecular Formula | C18H14Cl2N2 |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 2-[(E)-2-(2,6-dichlorophenyl)ethenyl]-1-prop-2-enylbenzimidazole |
| SMILES | C=CCn1c(/C=C/c2c(Cl)cccc2Cl)nc2ccccc21 |
| InChI | InChI=1S/C18H14Cl2N2/c1-2-12-22-17-9-4-3-8-16(17)21-18(22)11-10-13-14(19)6-5-7-15(13)20/h2-11H,1,12H2/b11-10+ |
| InChIKey | MAJDTVHKMUKRCP-ZHACJKMWSA-N |
| XLogP | 5.70 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|