C23H22ClNO4 — CID 18879694
7-chloro-2-methyl-1-(4-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18879694) has the molecular formula C23H22ClNO4 and a molecular weight of 411.89 g/mol. Its IUPAC name is 7-chloro-2-methyl-1-(4-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-chloro-2-methyl-1-(4-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18879694 |
| Molecular Formula | C23H22ClNO4 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 7-chloro-2-methyl-1-(4-pentoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCCOc1ccc(C2c3c(oc4ccc(Cl)cc4c3=O)C(=O)N2C)cc1 |
| InChI | InChI=1S/C23H22ClNO4/c1-3-4-5-12-28-16-9-6-14(7-10-16)20-19-21(26)17-13-15(24)8-11-18(17)29-22(19)23(27)25(20)2/h6-11,13,20H,3-5,12H2,1-2H3 |
| InChIKey | PFGPPTVFEUWUMS-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|