C21H13Cl4N3OS — CID 18880357
(5E)-3-(3,4-dichlorophenyl)-2-(3,4-dichlorophenyl)imino-5-[(1-methylpyrrol-2-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 18880357) has the molecular formula C21H13Cl4N3OS and a molecular weight of 497.23 g/mol. Its IUPAC name is (5E)-3-(3,4-dichlorophenyl)-2-(3,4-dichlorophenyl)imino-5-[(1-methylpyrrol-2-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(3,4-dichlorophenyl)-2-(3,4-dichlorophenyl)imino-5-[(1-methylpyrrol-2-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18880357 |
| Molecular Formula | C21H13Cl4N3OS |
| Molecular Weight | 497.23 g/mol |
| Exact Mass | 494.95 |
| IUPAC Name | (5E)-3-(3,4-dichlorophenyl)-2-(3,4-dichlorophenyl)imino-5-[(1-methylpyrrol-2-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cn1cccc1/C=C1/S/C(=N\c2ccc(Cl)c(Cl)c2)N(c2ccc(Cl)c(Cl)c2)C1=O |
| InChI | InChI=1S/C21H13Cl4N3OS/c1-27-8-2-3-13(27)11-19-20(29)28(14-5-7-16(23)18(25)10-14)21(30-19)26-12-4-6-15(22)17(24)9-12/h2-11H,1H3/b19-11+,26-21- |
| InChIKey | CUURPGAZALNEPI-VMVATSLTSA-N |
| XLogP | 7.45 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.23 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|