C26H29NO5 — CID 18880614
1-(4-butoxyphenyl)-2-(2-methoxyethyl)-5,7-dimethyl-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18880614) has the molecular formula C26H29NO5 and a molecular weight of 435.52 g/mol. Its IUPAC name is 1-(4-butoxyphenyl)-2-(2-methoxyethyl)-5,7-dimethyl-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(4-butoxyphenyl)-2-(2-methoxyethyl)-5,7-dimethyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18880614 |
| Molecular Formula | C26H29NO5 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | 1-(4-butoxyphenyl)-2-(2-methoxyethyl)-5,7-dimethyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCOc1ccc(C2c3c(oc4c(C)cc(C)cc4c3=O)C(=O)N2CCOC)cc1 |
| InChI | InChI=1S/C26H29NO5/c1-5-6-12-31-19-9-7-18(8-10-19)22-21-23(28)20-15-16(2)14-17(3)24(20)32-25(21)26(29)27(22)11-13-30-4/h7-10,14-15,22H,5-6,11-13H2,1-4H3 |
| InChIKey | SQQGIUNUQVLAPE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|