C27H30ClNO5 — CID 18882288
1-(4-butoxy-3-ethoxyphenyl)-7-chloro-6-methyl-2-propyl-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18882288) has the molecular formula C27H30ClNO5 and a molecular weight of 483.99 g/mol. Its IUPAC name is 1-(4-butoxy-3-ethoxyphenyl)-7-chloro-6-methyl-2-propyl-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(4-butoxy-3-ethoxyphenyl)-7-chloro-6-methyl-2-propyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18882288 |
| Molecular Formula | C27H30ClNO5 |
| Molecular Weight | 483.99 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | 1-(4-butoxy-3-ethoxyphenyl)-7-chloro-6-methyl-2-propyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCOc1ccc(C2c3c(oc4cc(C)c(Cl)cc4c3=O)C(=O)N2CCC)cc1OCC |
| InChI | InChI=1S/C27H30ClNO5/c1-5-8-12-33-20-10-9-17(14-22(20)32-7-3)24-23-25(30)18-15-19(28)16(4)13-21(18)34-26(23)27(31)29(24)11-6-2/h9-10,13-15,24H,5-8,11-12H2,1-4H3 |
| InChIKey | JUBBVQKMWCFICS-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.99 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|