C24H31N3O2 — CID 18885145
4-[[1-[4-(2,4-dimethylphenoxy)butyl]benzimidazol-2-yl]methyl]morpholine (PubChem CID 18885145) has the molecular formula C24H31N3O2 and a molecular weight of 393.53 g/mol. Its IUPAC name is 4-[[1-[4-(2,4-dimethylphenoxy)butyl]benzimidazol-2-yl]methyl]morpholine.
| Compound Name | 4-[[1-[4-(2,4-dimethylphenoxy)butyl]benzimidazol-2-yl]methyl]morpholine |
|---|---|
| PubChem CID | 18885145 |
| Molecular Formula | C24H31N3O2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | 4-[[1-[4-(2,4-dimethylphenoxy)butyl]benzimidazol-2-yl]methyl]morpholine |
| SMILES | Cc1ccc(OCCCCn2c(CN3CCOCC3)nc3ccccc32)c(C)c1 |
| InChI | InChI=1S/C24H31N3O2/c1-19-9-10-23(20(2)17-19)29-14-6-5-11-27-22-8-4-3-7-21(22)25-24(27)18-26-12-15-28-16-13-26/h3-4,7-10,17H,5-6,11-16,18H2,1-2H3 |
| InChIKey | AKCYHNHKPVMSAN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|