C24H31BrN4O2 — CID 18887526
N-[6-bromo-2-[4-(dimethylamino)phenyl]-4-oxo-1,2-dihydroquinazolin-3-yl]octanamide (PubChem CID 18887526) has the molecular formula C24H31BrN4O2 and a molecular weight of 487.44 g/mol. Its IUPAC name is N-[6-bromo-2-[4-(dimethylamino)phenyl]-4-oxo-1,2-dihydroquinazolin-3-yl]octanamide.
| Compound Name | N-[6-bromo-2-[4-(dimethylamino)phenyl]-4-oxo-1,2-dihydroquinazolin-3-yl]octanamide |
|---|---|
| PubChem CID | 18887526 |
| Molecular Formula | C24H31BrN4O2 |
| Molecular Weight | 487.44 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | N-[6-bromo-2-[4-(dimethylamino)phenyl]-4-oxo-1,2-dihydroquinazolin-3-yl]octanamide |
| SMILES | CCCCCCCC(=O)NN1C(=O)c2cc(Br)ccc2NC1c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C24H31BrN4O2/c1-4-5-6-7-8-9-22(30)27-29-23(17-10-13-19(14-11-17)28(2)3)26-21-15-12-18(25)16-20(21)24(29)31/h10-16,23,26H,4-9H2,1-3H3,(H,27,30) |
| InChIKey | NZRBMJVFOVORAF-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.44 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|