About 2-(benzylamino)-5-methyl-3-(2-nitrophenyl)furo[3,2-c]quinolin-4-one
2-(benzylamino)-5-methyl-3-(2-nitrophenyl)furo[3,2-c]quinolin-4-one (PubChem CID 18887779) has the molecular formula C25H19N3O4
and a molecular weight of 425.44 g/mol. Its IUPAC name is 2-(benzylamino)-5-methyl-3-(2-nitrophenyl)furo[3,2-c]quinolin-4-one.
Molecular Properties
| Compound Name | 2-(benzylamino)-5-methyl-3-(2-nitrophenyl)furo[3,2-c]quinolin-4-one |
| PubChem CID | 18887779 |
| Molecular Formula | C25H19N3O4 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 2-(benzylamino)-5-methyl-3-(2-nitrophenyl)furo[3,2-c]quinolin-4-one |
| SMILES | Cn1c(=O)c2c(-c3ccccc3[N+](=O)[O-])c(NCc3ccccc3)oc2c2ccccc21 |
| InChI | InChI=1S/C25H19N3O4/c1-27-19-13-7-6-12-18(19)23-22(25(27)29)21(17-11-5-8-14-20(17)28(30)31)24(32-23)26-15-16-9-3-2-4-10-16/h2-14,26H,15H2,1H3 |
| InChIKey | WTQSMXDZQOQTCZ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(benzylamino)-5-methyl-3-(2-nitrophenyl)furo[3,2-c]quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzylamino)-5-methyl-3-(2-nitrophenyl)furo[3,2-c]quinolin-4-one?
The IUPAC name of 2-(benzylamino)-5-methyl-3-(2-nitrophenyl)furo[3,2-c]quinolin-4-one (CID 18887779) is 2-(benzylamino)-5-methyl-3-(2-nitrophenyl)furo[3,2-c]quinolin-4-one.
What is the SMILES notation for 2-(benzylamino)-5-methyl-3-(2-nitrophenyl)furo[3,2-c]quinolin-4-one?
The canonical SMILES for 2-(benzylamino)-5-methyl-3-(2-nitrophenyl)furo[3,2-c]quinolin-4-one is Cn1c(=O)c2c(-c3ccccc3[N+](=O)[O-])c(NCc3ccccc3)oc2c2ccccc21.
What is the InChIKey of 2-(benzylamino)-5-methyl-3-(2-nitrophenyl)furo[3,2-c]quinolin-4-one?
The InChIKey is WTQSMXDZQOQTCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H19N3O4/c1-27-19-13-7-6-12-18(19)23-22(25(27)29)21(17-11-5-8-14-20(17)28(30)31)24(32-23)26-15-16-9-3-2-4-10-16/h2-14,26H,15H2,1H3.
What are the key properties of 2-(benzylamino)-5-methyl-3-(2-nitrophenyl)furo[3,2-c]quinolin-4-one?
2-(benzylamino)-5-methyl-3-(2-nitrophenyl)furo[3,2-c]quinolin-4-one has a molecular weight of 425.44 g/mol, XLogP of 5.47, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzylamino)-5-methyl-3-(2-nitrophenyl)furo[3,2-c]quinolin-4-one is sourced from PubChem (CID 18887779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).