C21H22FNO5S — CID 18888058
N-[6-(4-fluorophenyl)sulfanyl-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide (PubChem CID 18888058) has the molecular formula C21H22FNO5S and a molecular weight of 419.47 g/mol. Its IUPAC name is N-[6-(4-fluorophenyl)sulfanyl-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide.
| Compound Name | N-[6-(4-fluorophenyl)sulfanyl-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide |
|---|---|
| PubChem CID | 18888058 |
| Molecular Formula | C21H22FNO5S |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | N-[6-(4-fluorophenyl)sulfanyl-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide |
| SMILES | CC(=O)NC1C(Sc2ccc(F)cc2)OC2COC(c3ccccc3)OC2C1O |
| InChI | InChI=1S/C21H22FNO5S/c1-12(24)23-17-18(25)19-16(11-26-20(28-19)13-5-3-2-4-6-13)27-21(17)29-15-9-7-14(22)8-10-15/h2-10,16-21,25H,11H2,1H3,(H,23,24) |
| InChIKey | IPKRSKRHOGDKPZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |