C24H26FNO7S — CID 18888114
2-[[7-acetamido-6-(4-fluorophenyl)sulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]propanoic acid (PubChem CID 18888114) has the molecular formula C24H26FNO7S and a molecular weight of 491.54 g/mol. Its IUPAC name is 2-[[7-acetamido-6-(4-fluorophenyl)sulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]propanoic acid.
| Compound Name | 2-[[7-acetamido-6-(4-fluorophenyl)sulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]propanoic acid |
|---|---|
| PubChem CID | 18888114 |
| Molecular Formula | C24H26FNO7S |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | 2-[[7-acetamido-6-(4-fluorophenyl)sulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]propanoic acid |
| SMILES | CC(=O)NC1C(Sc2ccc(F)cc2)OC2COC(c3ccccc3)OC2C1OC(C)C(=O)O |
| InChI | InChI=1S/C24H26FNO7S/c1-13(22(28)29)31-21-19(26-14(2)27)24(34-17-10-8-16(25)9-11-17)32-18-12-30-23(33-20(18)21)15-6-4-3-5-7-15/h3-11,13,18-21,23-24H,12H2,1-2H3,(H,26,27)(H,28,29) |
| InChIKey | CBRXISQINZSYBH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |