C21H21Cl2NO4 — CID 18888687
6,7-dichloro-3-hydroxy-1-[3-(4-methylphenoxy)propyl]-3-(2-oxopropyl)indol-2-one (PubChem CID 18888687) has the molecular formula C21H21Cl2NO4 and a molecular weight of 422.31 g/mol. Its IUPAC name is 6,7-dichloro-3-hydroxy-1-[3-(4-methylphenoxy)propyl]-3-(2-oxopropyl)indol-2-one.
| Compound Name | 6,7-dichloro-3-hydroxy-1-[3-(4-methylphenoxy)propyl]-3-(2-oxopropyl)indol-2-one |
|---|---|
| PubChem CID | 18888687 |
| Molecular Formula | C21H21Cl2NO4 |
| Molecular Weight | 422.31 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 6,7-dichloro-3-hydroxy-1-[3-(4-methylphenoxy)propyl]-3-(2-oxopropyl)indol-2-one |
| SMILES | CC(=O)CC1(O)C(=O)N(CCCOc2ccc(C)cc2)c2c1ccc(Cl)c2Cl |
| InChI | InChI=1S/C21H21Cl2NO4/c1-13-4-6-15(7-5-13)28-11-3-10-24-19-16(8-9-17(22)18(19)23)21(27,20(24)26)12-14(2)25/h4-9,27H,3,10-12H2,1-2H3 |
| InChIKey | ZATRPNQXUBCFAL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.31 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|