C24H19Cl2N3O — CID 18889051
1-(4-chlorophenyl)-4-[1-[(4-chlorophenyl)methyl]benzimidazol-2-yl]pyrrolidin-2-one (PubChem CID 18889051) has the molecular formula C24H19Cl2N3O and a molecular weight of 436.34 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4-[1-[(4-chlorophenyl)methyl]benzimidazol-2-yl]pyrrolidin-2-one.
| Compound Name | 1-(4-chlorophenyl)-4-[1-[(4-chlorophenyl)methyl]benzimidazol-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 18889051 |
| Molecular Formula | C24H19Cl2N3O |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | 1-(4-chlorophenyl)-4-[1-[(4-chlorophenyl)methyl]benzimidazol-2-yl]pyrrolidin-2-one |
| SMILES | O=C1CC(c2nc3ccccc3n2Cc2ccc(Cl)cc2)CN1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H19Cl2N3O/c25-18-7-5-16(6-8-18)14-29-22-4-2-1-3-21(22)27-24(29)17-13-23(30)28(15-17)20-11-9-19(26)10-12-20/h1-12,17H,13-15H2 |
| InChIKey | MUESKUMPFZQFLR-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |