About 7'-methyl-1'-(3-methylbutyl)spiro[1,3-dioxane-2,3'-indole]-2'-one
7'-methyl-1'-(3-methylbutyl)spiro[1,3-dioxane-2,3'-indole]-2'-one (PubChem CID 18889438) has the molecular formula C17H23NO3
and a molecular weight of 289.38 g/mol. Its IUPAC name is 7'-methyl-1'-(3-methylbutyl)spiro[1,3-dioxane-2,3'-indole]-2'-one.
Molecular Properties
| Compound Name | 7'-methyl-1'-(3-methylbutyl)spiro[1,3-dioxane-2,3'-indole]-2'-one |
| PubChem CID | 18889438 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 7'-methyl-1'-(3-methylbutyl)spiro[1,3-dioxane-2,3'-indole]-2'-one |
| SMILES | Cc1cccc2c1N(CCC(C)C)C(=O)C21OCCCO1 |
| InChI | InChI=1S/C17H23NO3/c1-12(2)8-9-18-15-13(3)6-4-7-14(15)17(16(18)19)20-10-5-11-21-17/h4,6-7,12H,5,8-11H2,1-3H3 |
| InChIKey | OZHGGEXGHZPPJK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7'-methyl-1'-(3-methylbutyl)spiro[1,3-dioxane-2,3'-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7'-methyl-1'-(3-methylbutyl)spiro[1,3-dioxane-2,3'-indole]-2'-one?
The IUPAC name of 7'-methyl-1'-(3-methylbutyl)spiro[1,3-dioxane-2,3'-indole]-2'-one (CID 18889438) is 7'-methyl-1'-(3-methylbutyl)spiro[1,3-dioxane-2,3'-indole]-2'-one.
What is the SMILES notation for 7'-methyl-1'-(3-methylbutyl)spiro[1,3-dioxane-2,3'-indole]-2'-one?
The canonical SMILES for 7'-methyl-1'-(3-methylbutyl)spiro[1,3-dioxane-2,3'-indole]-2'-one is Cc1cccc2c1N(CCC(C)C)C(=O)C21OCCCO1.
What is the InChIKey of 7'-methyl-1'-(3-methylbutyl)spiro[1,3-dioxane-2,3'-indole]-2'-one?
The InChIKey is OZHGGEXGHZPPJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO3/c1-12(2)8-9-18-15-13(3)6-4-7-14(15)17(16(18)19)20-10-5-11-21-17/h4,6-7,12H,5,8-11H2,1-3H3.
What are the key properties of 7'-methyl-1'-(3-methylbutyl)spiro[1,3-dioxane-2,3'-indole]-2'-one?
7'-methyl-1'-(3-methylbutyl)spiro[1,3-dioxane-2,3'-indole]-2'-one has a molecular weight of 289.38 g/mol, XLogP of 2.98, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7'-methyl-1'-(3-methylbutyl)spiro[1,3-dioxane-2,3'-indole]-2'-one is sourced from PubChem (CID 18889438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).