C21H19Cl2NO4 — CID 18889582
6',7'-dichloro-1'-[(2-prop-2-enoxyphenyl)methyl]spiro[1,3-dioxane-2,3'-indole]-2'-one (PubChem CID 18889582) has the molecular formula C21H19Cl2NO4 and a molecular weight of 420.29 g/mol. Its IUPAC name is 6',7'-dichloro-1'-[(2-prop-2-enoxyphenyl)methyl]spiro[1,3-dioxane-2,3'-indole]-2'-one.
| Compound Name | 6',7'-dichloro-1'-[(2-prop-2-enoxyphenyl)methyl]spiro[1,3-dioxane-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 18889582 |
| Molecular Formula | C21H19Cl2NO4 |
| Molecular Weight | 420.29 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | 6',7'-dichloro-1'-[(2-prop-2-enoxyphenyl)methyl]spiro[1,3-dioxane-2,3'-indole]-2'-one |
| SMILES | C=CCOc1ccccc1CN1C(=O)C2(OCCCO2)c2ccc(Cl)c(Cl)c21 |
| InChI | InChI=1S/C21H19Cl2NO4/c1-2-10-26-17-7-4-3-6-14(17)13-24-19-15(8-9-16(22)18(19)23)21(20(24)25)27-11-5-12-28-21/h2-4,6-9H,1,5,10-13H2 |
| InChIKey | LLQPSUBINYYEKO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.29 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|