About 2-(4-tert-butylphenyl)-4-(4-fluorophenyl)sulfonyl-N,N-dimethyl-1,3-oxazol-5-amine
2-(4-tert-butylphenyl)-4-(4-fluorophenyl)sulfonyl-N,N-dimethyl-1,3-oxazol-5-amine (PubChem CID 18889884) has the molecular formula C21H23FN2O3S
and a molecular weight of 402.49 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-4-(4-fluorophenyl)sulfonyl-N,N-dimethyl-1,3-oxazol-5-amine.
Molecular Properties
| Compound Name | 2-(4-tert-butylphenyl)-4-(4-fluorophenyl)sulfonyl-N,N-dimethyl-1,3-oxazol-5-amine |
| PubChem CID | 18889884 |
| Molecular Formula | C21H23FN2O3S |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 2-(4-tert-butylphenyl)-4-(4-fluorophenyl)sulfonyl-N,N-dimethyl-1,3-oxazol-5-amine |
| SMILES | CN(C)c1oc(-c2ccc(C(C)(C)C)cc2)nc1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H23FN2O3S/c1-21(2,3)15-8-6-14(7-9-15)18-23-19(20(27-18)24(4)5)28(25,26)17-12-10-16(22)11-13-17/h6-13H,1-5H3 |
| InChIKey | LXVCMNXXQCOPQA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-tert-butylphenyl)-4-(4-fluorophenyl)sulfonyl-N,N-dimethyl-1,3-oxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-tert-butylphenyl)-4-(4-fluorophenyl)sulfonyl-N,N-dimethyl-1,3-oxazol-5-amine?
The IUPAC name of 2-(4-tert-butylphenyl)-4-(4-fluorophenyl)sulfonyl-N,N-dimethyl-1,3-oxazol-5-amine (CID 18889884) is 2-(4-tert-butylphenyl)-4-(4-fluorophenyl)sulfonyl-N,N-dimethyl-1,3-oxazol-5-amine.
What is the SMILES notation for 2-(4-tert-butylphenyl)-4-(4-fluorophenyl)sulfonyl-N,N-dimethyl-1,3-oxazol-5-amine?
The canonical SMILES for 2-(4-tert-butylphenyl)-4-(4-fluorophenyl)sulfonyl-N,N-dimethyl-1,3-oxazol-5-amine is CN(C)c1oc(-c2ccc(C(C)(C)C)cc2)nc1S(=O)(=O)c1ccc(F)cc1.
What is the InChIKey of 2-(4-tert-butylphenyl)-4-(4-fluorophenyl)sulfonyl-N,N-dimethyl-1,3-oxazol-5-amine?
The InChIKey is LXVCMNXXQCOPQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23FN2O3S/c1-21(2,3)15-8-6-14(7-9-15)18-23-19(20(27-18)24(4)5)28(25,26)17-12-10-16(22)11-13-17/h6-13H,1-5H3.
What are the key properties of 2-(4-tert-butylphenyl)-4-(4-fluorophenyl)sulfonyl-N,N-dimethyl-1,3-oxazol-5-amine?
2-(4-tert-butylphenyl)-4-(4-fluorophenyl)sulfonyl-N,N-dimethyl-1,3-oxazol-5-amine has a molecular weight of 402.49 g/mol, XLogP of 4.68, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-tert-butylphenyl)-4-(4-fluorophenyl)sulfonyl-N,N-dimethyl-1,3-oxazol-5-amine is sourced from PubChem (CID 18889884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).