About 4-[4-(4-ethylphenyl)sulfonyl-2-naphthalen-1-yl-1,3-oxazol-5-yl]morpholine
4-[4-(4-ethylphenyl)sulfonyl-2-naphthalen-1-yl-1,3-oxazol-5-yl]morpholine (PubChem CID 18890424) has the molecular formula C25H24N2O4S
and a molecular weight of 448.54 g/mol. Its IUPAC name is 4-[4-(4-ethylphenyl)sulfonyl-2-naphthalen-1-yl-1,3-oxazol-5-yl]morpholine.
Molecular Properties
| Compound Name | 4-[4-(4-ethylphenyl)sulfonyl-2-naphthalen-1-yl-1,3-oxazol-5-yl]morpholine |
| PubChem CID | 18890424 |
| Molecular Formula | C25H24N2O4S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 4-[4-(4-ethylphenyl)sulfonyl-2-naphthalen-1-yl-1,3-oxazol-5-yl]morpholine |
| SMILES | CCc1ccc(S(=O)(=O)c2nc(-c3cccc4ccccc34)oc2N2CCOCC2)cc1 |
| InChI | InChI=1S/C25H24N2O4S/c1-2-18-10-12-20(13-11-18)32(28,29)24-25(27-14-16-30-17-15-27)31-23(26-24)22-9-5-7-19-6-3-4-8-21(19)22/h3-13H,2,14-17H2,1H3 |
| InChIKey | NVKQPENIGTXYBB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[4-(4-ethylphenyl)sulfonyl-2-naphthalen-1-yl-1,3-oxazol-5-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(4-ethylphenyl)sulfonyl-2-naphthalen-1-yl-1,3-oxazol-5-yl]morpholine?
The IUPAC name of 4-[4-(4-ethylphenyl)sulfonyl-2-naphthalen-1-yl-1,3-oxazol-5-yl]morpholine (CID 18890424) is 4-[4-(4-ethylphenyl)sulfonyl-2-naphthalen-1-yl-1,3-oxazol-5-yl]morpholine.
What is the SMILES notation for 4-[4-(4-ethylphenyl)sulfonyl-2-naphthalen-1-yl-1,3-oxazol-5-yl]morpholine?
The canonical SMILES for 4-[4-(4-ethylphenyl)sulfonyl-2-naphthalen-1-yl-1,3-oxazol-5-yl]morpholine is CCc1ccc(S(=O)(=O)c2nc(-c3cccc4ccccc34)oc2N2CCOCC2)cc1.
What is the InChIKey of 4-[4-(4-ethylphenyl)sulfonyl-2-naphthalen-1-yl-1,3-oxazol-5-yl]morpholine?
The InChIKey is NVKQPENIGTXYBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24N2O4S/c1-2-18-10-12-20(13-11-18)32(28,29)24-25(27-14-16-30-17-15-27)31-23(26-24)22-9-5-7-19-6-3-4-8-21(19)22/h3-13H,2,14-17H2,1H3.
What are the key properties of 4-[4-(4-ethylphenyl)sulfonyl-2-naphthalen-1-yl-1,3-oxazol-5-yl]morpholine?
4-[4-(4-ethylphenyl)sulfonyl-2-naphthalen-1-yl-1,3-oxazol-5-yl]morpholine has a molecular weight of 448.54 g/mol, XLogP of 4.73, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(4-ethylphenyl)sulfonyl-2-naphthalen-1-yl-1,3-oxazol-5-yl]morpholine is sourced from PubChem (CID 18890424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).