C35H39NO7 — CID 18890705
2-[2-(3,4-dimethoxyphenyl)ethyl]-1-(3-methoxy-4-pentoxyphenyl)-6,8-dimethyl-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18890705) has the molecular formula C35H39NO7 and a molecular weight of 585.70 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)ethyl]-1-(3-methoxy-4-pentoxyphenyl)-6,8-dimethyl-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)ethyl]-1-(3-methoxy-4-pentoxyphenyl)-6,8-dimethyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18890705 |
| Molecular Formula | C35H39NO7 |
| Molecular Weight | 585.70 g/mol |
| Exact Mass | 585.27 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)ethyl]-1-(3-methoxy-4-pentoxyphenyl)-6,8-dimethyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCCOc1ccc(C2c3c(oc4cc(C)cc(C)c4c3=O)C(=O)N2CCc2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C35H39NO7/c1-7-8-9-16-42-26-13-11-24(20-28(26)41-6)32-31-33(37)30-22(3)17-21(2)18-29(30)43-34(31)35(38)36(32)15-14-23-10-12-25(39-4)27(19-23)40-5/h10-13,17-20,32H,7-9,14-16H2,1-6H3 |
| InChIKey | MUNSQOZOOLLEOV-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 87.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.70 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|