C31H29NO5 — CID 18890904
2-[2-(4-methoxyphenyl)ethyl]-6,8-dimethyl-1-(4-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18890904) has the molecular formula C31H29NO5 and a molecular weight of 495.58 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenyl)ethyl]-6,8-dimethyl-1-(4-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 2-[2-(4-methoxyphenyl)ethyl]-6,8-dimethyl-1-(4-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18890904 |
| Molecular Formula | C31H29NO5 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | 2-[2-(4-methoxyphenyl)ethyl]-6,8-dimethyl-1-(4-prop-2-enoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | C=CCOc1ccc(C2c3c(oc4cc(C)cc(C)c4c3=O)C(=O)N2CCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H29NO5/c1-5-16-36-24-12-8-22(9-13-24)28-27-29(33)26-20(3)17-19(2)18-25(26)37-30(27)31(34)32(28)15-14-21-6-10-23(35-4)11-7-21/h5-13,17-18,28H,1,14-16H2,2-4H3 |
| InChIKey | KYYVMDPHJALXMR-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|