C18H29N3S — CID 18891858
5,5-dibutyl-2-(3,4-dimethylphenyl)-1,2,4-triazolidine-3-thione (PubChem CID 18891858) has the molecular formula C18H29N3S and a molecular weight of 319.52 g/mol. Its IUPAC name is 5,5-dibutyl-2-(3,4-dimethylphenyl)-1,2,4-triazolidine-3-thione.
| Compound Name | 5,5-dibutyl-2-(3,4-dimethylphenyl)-1,2,4-triazolidine-3-thione |
|---|---|
| PubChem CID | 18891858 |
| Molecular Formula | C18H29N3S |
| Molecular Weight | 319.52 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 5,5-dibutyl-2-(3,4-dimethylphenyl)-1,2,4-triazolidine-3-thione |
| SMILES | CCCCC1(CCCC)NC(=S)N(c2ccc(C)c(C)c2)N1 |
| InChI | InChI=1S/C18H29N3S/c1-5-7-11-18(12-8-6-2)19-17(22)21(20-18)16-10-9-14(3)15(4)13-16/h9-10,13,20H,5-8,11-12H2,1-4H3,(H,19,22) |
| InChIKey | KMFSZYNBZMMPBX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.52 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|