C16H11N5O2S2 — CID 18893841
2-amino-6-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanyl-4-thiophen-2-ylpyridine-3,5-dicarbonitrile (PubChem CID 18893841) has the molecular formula C16H11N5O2S2 and a molecular weight of 369.43 g/mol. Its IUPAC name is 2-amino-6-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanyl-4-thiophen-2-ylpyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-6-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanyl-4-thiophen-2-ylpyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 18893841 |
| Molecular Formula | C16H11N5O2S2 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | 2-amino-6-(1-methyl-2,5-dioxopyrrolidin-3-yl)sulfanyl-4-thiophen-2-ylpyridine-3,5-dicarbonitrile |
| SMILES | CN1C(=O)CC(Sc2nc(N)c(C#N)c(-c3cccs3)c2C#N)C1=O |
| InChI | InChI=1S/C16H11N5O2S2/c1-21-12(22)5-11(16(21)23)25-15-9(7-18)13(10-3-2-4-24-10)8(6-17)14(19)20-15/h2-4,11H,5H2,1H3,(H2,19,20) |
| InChIKey | MABSCRKPILKHDY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 123.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|