C20H24N4 — CID 18894
3-[(4-benzylpiperazin-1-yl)methyl]-1H-indol-5-amine (PubChem CID 18894) has the molecular formula C20H24N4 and a molecular weight of 320.44 g/mol. Its IUPAC name is 3-[(4-benzylpiperazin-1-yl)methyl]-1H-indol-5-amine.
| Compound Name | 3-[(4-benzylpiperazin-1-yl)methyl]-1H-indol-5-amine |
|---|---|
| PubChem CID | 18894 |
| Molecular Formula | C20H24N4 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 3-[(4-benzylpiperazin-1-yl)methyl]-1H-indol-5-amine |
| SMILES | Nc1ccc2[nH]cc(CN3CCN(Cc4ccccc4)CC3)c2c1 |
| InChI | InChI=1S/C20H24N4/c21-18-6-7-20-19(12-18)17(13-22-20)15-24-10-8-23(9-11-24)14-16-4-2-1-3-5-16/h1-7,12-13,22H,8-11,14-15,21H2 |
| InChIKey | FOXCFIPZINDAQU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|