About 2-(3-aminophenyl)sulfanyl-N,N-dicyclohexylacetamide
2-(3-aminophenyl)sulfanyl-N,N-dicyclohexylacetamide (PubChem CID 18894930) has the molecular formula C20H30N2OS
and a molecular weight of 346.54 g/mol. Its IUPAC name is 2-(3-aminophenyl)sulfanyl-N,N-dicyclohexylacetamide.
Molecular Properties
| Compound Name | 2-(3-aminophenyl)sulfanyl-N,N-dicyclohexylacetamide |
| PubChem CID | 18894930 |
| Molecular Formula | C20H30N2OS |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 2-(3-aminophenyl)sulfanyl-N,N-dicyclohexylacetamide |
| SMILES | Nc1cccc(SCC(=O)N(C2CCCCC2)C2CCCCC2)c1 |
| InChI | InChI=1S/C20H30N2OS/c21-16-8-7-13-19(14-16)24-15-20(23)22(17-9-3-1-4-10-17)18-11-5-2-6-12-18/h7-8,13-14,17-18H,1-6,9-12,15,21H2 |
| InChIKey | CEXXPTZKFBTFLR-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-aminophenyl)sulfanyl-N,N-dicyclohexylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-aminophenyl)sulfanyl-N,N-dicyclohexylacetamide?
The IUPAC name of 2-(3-aminophenyl)sulfanyl-N,N-dicyclohexylacetamide (CID 18894930) is 2-(3-aminophenyl)sulfanyl-N,N-dicyclohexylacetamide.
What is the SMILES notation for 2-(3-aminophenyl)sulfanyl-N,N-dicyclohexylacetamide?
The canonical SMILES for 2-(3-aminophenyl)sulfanyl-N,N-dicyclohexylacetamide is Nc1cccc(SCC(=O)N(C2CCCCC2)C2CCCCC2)c1.
What is the InChIKey of 2-(3-aminophenyl)sulfanyl-N,N-dicyclohexylacetamide?
The InChIKey is CEXXPTZKFBTFLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30N2OS/c21-16-8-7-13-19(14-16)24-15-20(23)22(17-9-3-1-4-10-17)18-11-5-2-6-12-18/h7-8,13-14,17-18H,1-6,9-12,15,21H2.
What are the key properties of 2-(3-aminophenyl)sulfanyl-N,N-dicyclohexylacetamide?
2-(3-aminophenyl)sulfanyl-N,N-dicyclohexylacetamide has a molecular weight of 346.54 g/mol, XLogP of 4.85, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-aminophenyl)sulfanyl-N,N-dicyclohexylacetamide is sourced from PubChem (CID 18894930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).