C34H29Cl4N3O6S2 — CID 18897771
2-[[3-[1-[(6-benzyl-3-methoxycarbonyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)amino]-1-oxobutan-2-yl]sulfanylphenyl]carbamoyl]-3,4,5,6-tetrachlorobenzoic acid (PubChem CID 18897771) has the molecular formula C34H29Cl4N3O6S2 and a molecular weight of 781.57 g/mol. Its IUPAC name is 2-[[3-[1-[(6-benzyl-3-methoxycarbonyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)amino]-1-oxobutan-2-yl]sulfanylphenyl]carbamoyl]-3,4,5,6-tetrachlorobenzoic acid.
| Compound Name | 2-[[3-[1-[(6-benzyl-3-methoxycarbonyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)amino]-1-oxobutan-2-yl]sulfanylphenyl]carbamoyl]-3,4,5,6-tetrachlorobenzoic acid |
|---|---|
| PubChem CID | 18897771 |
| Molecular Formula | C34H29Cl4N3O6S2 |
| Molecular Weight | 781.57 g/mol |
| Exact Mass | 779.03 |
| IUPAC Name | 2-[[3-[1-[(6-benzyl-3-methoxycarbonyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)amino]-1-oxobutan-2-yl]sulfanylphenyl]carbamoyl]-3,4,5,6-tetrachlorobenzoic acid |
| SMILES | CCC(Sc1cccc(NC(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)O)c1)C(=O)Nc1sc2c(c1C(=O)OC)CCN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C34H29Cl4N3O6S2/c1-3-21(48-19-11-7-10-18(14-19)39-31(43)24-25(33(44)45)27(36)29(38)28(37)26(24)35)30(42)40-32-23(34(46)47-2)20-12-13-41(16-22(20)49-32)15-17-8-5-4-6-9-17/h4-11,14,21H,3,12-13,15-16H2,1-2H3,(H,39,43)(H,40,42)(H,44,45) |
| InChIKey | ZBSSIINPTKMZRX-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.57 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|