C32H25N3O6S2 — CID 18897989
4-[[3-[2-[(3-cyano-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanylphenyl]carbamoyl]benzene-1,3-dicarboxylic acid (PubChem CID 18897989) has the molecular formula C32H25N3O6S2 and a molecular weight of 611.70 g/mol. Its IUPAC name is 4-[[3-[2-[(3-cyano-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanylphenyl]carbamoyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 4-[[3-[2-[(3-cyano-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanylphenyl]carbamoyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 18897989 |
| Molecular Formula | C32H25N3O6S2 |
| Molecular Weight | 611.70 g/mol |
| Exact Mass | 611.12 |
| IUPAC Name | 4-[[3-[2-[(3-cyano-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoethyl]sulfanylphenyl]carbamoyl]benzene-1,3-dicarboxylic acid |
| SMILES | N#Cc1c(NC(=O)CSc2cccc(NC(=O)c3ccc(C(=O)O)cc3C(=O)O)c2)sc2c1CCC(c1ccccc1)C2 |
| InChI | InChI=1S/C32H25N3O6S2/c33-16-26-23-11-9-19(18-5-2-1-3-6-18)14-27(23)43-30(26)35-28(36)17-42-22-8-4-7-21(15-22)34-29(37)24-12-10-20(31(38)39)13-25(24)32(40)41/h1-8,10,12-13,15,19H,9,11,14,17H2,(H,34,37)(H,35,36)(H,38,39)(H,40,41) |
| InChIKey | UOVWJSJMEQPRRM-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 156.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.70 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |