C18H18Cl2N2O2S — CID 18901090
2-(3-acetamidophenyl)sulfanyl-N-(3,4-dichlorophenyl)butanamide (PubChem CID 18901090) has the molecular formula C18H18Cl2N2O2S and a molecular weight of 397.33 g/mol. Its IUPAC name is 2-(3-acetamidophenyl)sulfanyl-N-(3,4-dichlorophenyl)butanamide.
| Compound Name | 2-(3-acetamidophenyl)sulfanyl-N-(3,4-dichlorophenyl)butanamide |
|---|---|
| PubChem CID | 18901090 |
| Molecular Formula | C18H18Cl2N2O2S |
| Molecular Weight | 397.33 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | 2-(3-acetamidophenyl)sulfanyl-N-(3,4-dichlorophenyl)butanamide |
| SMILES | CCC(Sc1cccc(NC(C)=O)c1)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H18Cl2N2O2S/c1-3-17(18(24)22-13-7-8-15(19)16(20)10-13)25-14-6-4-5-12(9-14)21-11(2)23/h4-10,17H,3H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | KIFVRDYKXGNABH-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.33 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |