About benzyl N-hydroxycarbamate
benzyl N-hydroxycarbamate (PubChem CID 18907) has the molecular formula C8H9NO3
and a molecular weight of 167.16 g/mol. Its IUPAC name is benzyl N-hydroxycarbamate.
Molecular Properties
| Compound Name | benzyl N-hydroxycarbamate |
| PubChem CID | 18907 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | benzyl N-hydroxycarbamate |
| SMILES | O=C(NO)OCc1ccccc1 |
| InChI | InChI=1S/C8H9NO3/c10-8(9-11)12-6-7-4-2-1-3-5-7/h1-5,11H,6H2,(H,9,10) |
| InChIKey | PQBSPTAPCMSZAA-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzyl N-hydroxycarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-hydroxycarbamate?
The IUPAC name of benzyl N-hydroxycarbamate (CID 18907) is benzyl N-hydroxycarbamate.
What is the SMILES notation for benzyl N-hydroxycarbamate?
The canonical SMILES for benzyl N-hydroxycarbamate is O=C(NO)OCc1ccccc1.
What is the InChIKey of benzyl N-hydroxycarbamate?
The InChIKey is PQBSPTAPCMSZAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO3/c10-8(9-11)12-6-7-4-2-1-3-5-7/h1-5,11H,6H2,(H,9,10).
What are the key properties of benzyl N-hydroxycarbamate?
benzyl N-hydroxycarbamate has a molecular weight of 167.16 g/mol, XLogP of 1.30, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-hydroxycarbamate is sourced from PubChem (CID 18907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).