C25H19BrN2O2S — CID 18908205
N-[3-[2-(2-bromoanilino)-2-oxoethyl]sulfanylphenyl]naphthalene-2-carboxamide (PubChem CID 18908205) has the molecular formula C25H19BrN2O2S and a molecular weight of 491.41 g/mol. Its IUPAC name is N-[3-[2-(2-bromoanilino)-2-oxoethyl]sulfanylphenyl]naphthalene-2-carboxamide.
| Compound Name | N-[3-[2-(2-bromoanilino)-2-oxoethyl]sulfanylphenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 18908205 |
| Molecular Formula | C25H19BrN2O2S |
| Molecular Weight | 491.41 g/mol |
| Exact Mass | 490.04 |
| IUPAC Name | N-[3-[2-(2-bromoanilino)-2-oxoethyl]sulfanylphenyl]naphthalene-2-carboxamide |
| SMILES | O=C(CSc1cccc(NC(=O)c2ccc3ccccc3c2)c1)Nc1ccccc1Br |
| InChI | InChI=1S/C25H19BrN2O2S/c26-22-10-3-4-11-23(22)28-24(29)16-31-21-9-5-8-20(15-21)27-25(30)19-13-12-17-6-1-2-7-18(17)14-19/h1-15H,16H2,(H,27,30)(H,28,29) |
| InChIKey | PTJZTONWCPCVHG-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.41 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |