About 9-methyl-3,9-diazabicyclo[3.3.1]nonane;dihydrochloride
9-methyl-3,9-diazabicyclo[3.3.1]nonane;dihydrochloride (PubChem CID 18910) has the molecular formula C8H18Cl2N2
and a molecular weight of 213.15 g/mol. Its IUPAC name is 9-methyl-3,9-diazabicyclo[3.3.1]nonane;dihydrochloride.
Molecular Properties
| Compound Name | 9-methyl-3,9-diazabicyclo[3.3.1]nonane;dihydrochloride |
| PubChem CID | 18910 |
| Molecular Formula | C8H18Cl2N2 |
| Molecular Weight | 213.15 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 9-methyl-3,9-diazabicyclo[3.3.1]nonane;dihydrochloride |
| SMILES | CN1C2CCCC1CNC2.Cl.Cl |
| InChI | InChI=1S/C8H16N2.2ClH/c1-10-7-3-2-4-8(10)6-9-5-7;;/h7-9H,2-6H2,1H3;2*1H |
| InChIKey | KJLUHXBQTQMMOX-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.15 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-methyl-3,9-diazabicyclo[3.3.1]nonane;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-3,9-diazabicyclo[3.3.1]nonane;dihydrochloride?
The IUPAC name of 9-methyl-3,9-diazabicyclo[3.3.1]nonane;dihydrochloride (CID 18910) is 9-methyl-3,9-diazabicyclo[3.3.1]nonane;dihydrochloride.
What is the SMILES notation for 9-methyl-3,9-diazabicyclo[3.3.1]nonane;dihydrochloride?
The canonical SMILES for 9-methyl-3,9-diazabicyclo[3.3.1]nonane;dihydrochloride is CN1C2CCCC1CNC2.Cl.Cl.
What is the InChIKey of 9-methyl-3,9-diazabicyclo[3.3.1]nonane;dihydrochloride?
The InChIKey is KJLUHXBQTQMMOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2.2ClH/c1-10-7-3-2-4-8(10)6-9-5-7;;/h7-9H,2-6H2,1H3;2*1H.
What are the key properties of 9-methyl-3,9-diazabicyclo[3.3.1]nonane;dihydrochloride?
9-methyl-3,9-diazabicyclo[3.3.1]nonane;dihydrochloride has a molecular weight of 213.15 g/mol, XLogP of 1.29, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-3,9-diazabicyclo[3.3.1]nonane;dihydrochloride is sourced from PubChem (CID 18910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).