C38H42N4O6S3 — CID 18912233
6-O-tert-butyl 3-O-ethyl 2-[2-[3-(4a,10a-dihydrophenothiazine-10-carbonylamino)phenyl]sulfanylbutanoylamino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate (PubChem CID 18912233) has the molecular formula C38H42N4O6S3 and a molecular weight of 746.98 g/mol. Its IUPAC name is 6-O-tert-butyl 3-O-ethyl 2-[2-[3-(4a,10a-dihydrophenothiazine-10-carbonylamino)phenyl]sulfanylbutanoylamino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate.
| Compound Name | 6-O-tert-butyl 3-O-ethyl 2-[2-[3-(4a,10a-dihydrophenothiazine-10-carbonylamino)phenyl]sulfanylbutanoylamino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate |
|---|---|
| PubChem CID | 18912233 |
| Molecular Formula | C38H42N4O6S3 |
| Molecular Weight | 746.98 g/mol |
| Exact Mass | 746.23 |
| IUPAC Name | 6-O-tert-butyl 3-O-ethyl 2-[2-[3-(4a,10a-dihydrophenothiazine-10-carbonylamino)phenyl]sulfanylbutanoylamino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(CC)Sc2cccc(NC(=O)N3c4ccccc4SC4C=CC=CC43)c2)sc2c1CCN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C38H42N4O6S3/c1-6-28(33(43)40-34-32(35(44)47-7-2)25-19-20-41(22-31(25)51-34)37(46)48-38(3,4)5)49-24-14-12-13-23(21-24)39-36(45)42-26-15-8-10-17-29(26)50-30-18-11-9-16-27(30)42/h8-18,21,26,28-29H,6-7,19-20,22H2,1-5H3,(H,39,45)(H,40,43) |
| InChIKey | VHPZIQGJLCYIJL-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.98 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |