C11H18N4 — CID 18913437
Pentanenitrile, 2-[2-(1-cyano-1-methylpropyl)diazenyl]-2-methyl- (PubChem CID 18913437) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-(2-cyanobutan-2-yldiazenyl)-2-methylpentanenitrile.
| Compound Name | Pentanenitrile, 2-[2-(1-cyano-1-methylpropyl)diazenyl]-2-methyl- |
|---|---|
| PubChem CID | 18913437 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 2-(2-cyanobutan-2-yldiazenyl)-2-methylpentanenitrile |
| SMILES | CCCC(C)(C#N)N=NC(C)(CC)C#N |
| InChI | InChI=1S/C11H18N4/c1-5-7-11(4,9-13)15-14-10(3,6-2)8-12/h5-7H2,1-4H3 |
| InChIKey | SJLBDNZUZIGHNK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | 329 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|