C29H29O2- — CID 18913650
4-[(E)-4-[6-(4-tert-butylphenyl)-3,3-dimethylcyclohexa-1,5-dien-1-yl]but-3-en-1-ynyl]benzoate (PubChem CID 18913650) has the molecular formula C29H29O2- and a molecular weight of 409.55 g/mol. Its IUPAC name is 4-[(E)-4-[6-(4-tert-butylphenyl)-3,3-dimethylcyclohexa-1,5-dien-1-yl]but-3-en-1-ynyl]benzoate.
| Compound Name | 4-[(E)-4-[6-(4-tert-butylphenyl)-3,3-dimethylcyclohexa-1,5-dien-1-yl]but-3-en-1-ynyl]benzoate |
|---|---|
| PubChem CID | 18913650 |
| Molecular Formula | C29H29O2- |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | 4-[(E)-4-[6-(4-tert-butylphenyl)-3,3-dimethylcyclohexa-1,5-dien-1-yl]but-3-en-1-ynyl]benzoate |
| SMILES | CC1(C)C=C(/C=C/C#Cc2ccc(C(=O)[O-])cc2)C(c2ccc(C(C)(C)C)cc2)=CC1 |
| InChI | InChI=1S/C29H30O2/c1-28(2,3)25-16-14-22(15-17-25)26-18-19-29(4,5)20-24(26)9-7-6-8-21-10-12-23(13-11-21)27(30)31/h7,9-18,20H,19H2,1-5H3,(H,30,31)/p-1/b9-7+ |
| InChIKey | JVBZGDKQEREYMT-VQHVLOKHSA-M |
| XLogP | 5.70 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|