C10H14F8O — CID 18913766
1,1,1,2-tetrafluoro-3-methyl-2-(1,1,1,2-tetrafluoro-3-methylbutan-2-yl)oxybutane (PubChem CID 18913766) has the molecular formula C10H14F8O and a molecular weight of 302.21 g/mol. Its IUPAC name is 1,1,1,2-tetrafluoro-3-methyl-2-(1,1,1,2-tetrafluoro-3-methylbutan-2-yl)oxybutane.
| Compound Name | 1,1,1,2-tetrafluoro-3-methyl-2-(1,1,1,2-tetrafluoro-3-methylbutan-2-yl)oxybutane |
|---|---|
| PubChem CID | 18913766 |
| Molecular Formula | C10H14F8O |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 1,1,1,2-tetrafluoro-3-methyl-2-(1,1,1,2-tetrafluoro-3-methylbutan-2-yl)oxybutane |
| SMILES | CC(C)C(F)(OC(F)(C(C)C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H14F8O/c1-5(2)7(11,9(13,14)15)19-8(12,6(3)4)10(16,17)18/h5-6H,1-4H3 |
| InChIKey | JZOJMFNVCYKIMJ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |