About 1,3-benzothiazol-2-yl N,N-dimethylcarbamodithioate
1,3-benzothiazol-2-yl N,N-dimethylcarbamodithioate (PubChem CID 18914) has the molecular formula C10H10N2S3
and a molecular weight of 254.41 g/mol. Its IUPAC name is 1,3-benzothiazol-2-yl N,N-dimethylcarbamodithioate.
Molecular Properties
| Compound Name | 1,3-benzothiazol-2-yl N,N-dimethylcarbamodithioate |
| PubChem CID | 18914 |
| Molecular Formula | C10H10N2S3 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.00 |
| IUPAC Name | 1,3-benzothiazol-2-yl N,N-dimethylcarbamodithioate |
| SMILES | CN(C)C(=S)Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C10H10N2S3/c1-12(2)10(13)15-9-11-7-5-3-4-6-8(7)14-9/h3-6H,1-2H3 |
| InChIKey | DQXSUEZFMYQFSC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,3-benzothiazol-2-yl N,N-dimethylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzothiazol-2-yl N,N-dimethylcarbamodithioate?
The IUPAC name of 1,3-benzothiazol-2-yl N,N-dimethylcarbamodithioate (CID 18914) is 1,3-benzothiazol-2-yl N,N-dimethylcarbamodithioate.
What is the SMILES notation for 1,3-benzothiazol-2-yl N,N-dimethylcarbamodithioate?
The canonical SMILES for 1,3-benzothiazol-2-yl N,N-dimethylcarbamodithioate is CN(C)C(=S)Sc1nc2ccccc2s1.
What is the InChIKey of 1,3-benzothiazol-2-yl N,N-dimethylcarbamodithioate?
The InChIKey is DQXSUEZFMYQFSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2S3/c1-12(2)10(13)15-9-11-7-5-3-4-6-8(7)14-9/h3-6H,1-2H3.
What are the key properties of 1,3-benzothiazol-2-yl N,N-dimethylcarbamodithioate?
1,3-benzothiazol-2-yl N,N-dimethylcarbamodithioate has a molecular weight of 254.41 g/mol, XLogP of 3.23, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzothiazol-2-yl N,N-dimethylcarbamodithioate is sourced from PubChem (CID 18914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).