C26H38N2O4 — CID 18914019
N,1-bis[(3,4-diethoxyphenyl)methyl]pyrrolidin-3-amine (PubChem CID 18914019) has the molecular formula C26H38N2O4 and a molecular weight of 442.60 g/mol. Its IUPAC name is N,1-bis[(3,4-diethoxyphenyl)methyl]pyrrolidin-3-amine.
| Compound Name | N,1-bis[(3,4-diethoxyphenyl)methyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 18914019 |
| Molecular Formula | C26H38N2O4 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | N,1-bis[(3,4-diethoxyphenyl)methyl]pyrrolidin-3-amine |
| SMILES | CCOc1ccc(CNC2CCN(Cc3ccc(OCC)c(OCC)c3)C2)cc1OCC |
| InChI | InChI=1S/C26H38N2O4/c1-5-29-23-11-9-20(15-25(23)31-7-3)17-27-22-13-14-28(19-22)18-21-10-12-24(30-6-2)26(16-21)32-8-4/h9-12,15-16,22,27H,5-8,13-14,17-19H2,1-4H3 |
| InChIKey | XEMDAQUDGQLDGQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 52.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |