About 2-(3,4-dihydro-2H-chromen-4-yl)-N,N-dimethylacetamide
2-(3,4-dihydro-2H-chromen-4-yl)-N,N-dimethylacetamide (PubChem CID 18914095) has the molecular formula C13H17NO2
and a molecular weight of 219.28 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-chromen-4-yl)-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-(3,4-dihydro-2H-chromen-4-yl)-N,N-dimethylacetamide |
| PubChem CID | 18914095 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 2-(3,4-dihydro-2H-chromen-4-yl)-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CC1CCOc2ccccc21 |
| InChI | InChI=1S/C13H17NO2/c1-14(2)13(15)9-10-7-8-16-12-6-4-3-5-11(10)12/h3-6,10H,7-9H2,1-2H3 |
| InChIKey | ABRNQOUKNUZCPP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3,4-dihydro-2H-chromen-4-yl)-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dihydro-2H-chromen-4-yl)-N,N-dimethylacetamide?
The IUPAC name of 2-(3,4-dihydro-2H-chromen-4-yl)-N,N-dimethylacetamide (CID 18914095) is 2-(3,4-dihydro-2H-chromen-4-yl)-N,N-dimethylacetamide.
What is the SMILES notation for 2-(3,4-dihydro-2H-chromen-4-yl)-N,N-dimethylacetamide?
The canonical SMILES for 2-(3,4-dihydro-2H-chromen-4-yl)-N,N-dimethylacetamide is CN(C)C(=O)CC1CCOc2ccccc21.
What is the InChIKey of 2-(3,4-dihydro-2H-chromen-4-yl)-N,N-dimethylacetamide?
The InChIKey is ABRNQOUKNUZCPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2/c1-14(2)13(15)9-10-7-8-16-12-6-4-3-5-11(10)12/h3-6,10H,7-9H2,1-2H3.
What are the key properties of 2-(3,4-dihydro-2H-chromen-4-yl)-N,N-dimethylacetamide?
2-(3,4-dihydro-2H-chromen-4-yl)-N,N-dimethylacetamide has a molecular weight of 219.28 g/mol, XLogP of 2.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dihydro-2H-chromen-4-yl)-N,N-dimethylacetamide is sourced from PubChem (CID 18914095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).