C26H33FN2O2 — CID 18914201
[4-[(4-fluorophenyl)methoxy]-3-(2-methylprop-2-enyl)phenyl]-[4-(2-methylpropyl)piperazin-1-yl]methanone (PubChem CID 18914201) has the molecular formula C26H33FN2O2 and a molecular weight of 424.56 g/mol. Its IUPAC name is [4-[(4-fluorophenyl)methoxy]-3-(2-methylprop-2-enyl)phenyl]-[4-(2-methylpropyl)piperazin-1-yl]methanone.
| Compound Name | [4-[(4-fluorophenyl)methoxy]-3-(2-methylprop-2-enyl)phenyl]-[4-(2-methylpropyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 18914201 |
| Molecular Formula | C26H33FN2O2 |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | [4-[(4-fluorophenyl)methoxy]-3-(2-methylprop-2-enyl)phenyl]-[4-(2-methylpropyl)piperazin-1-yl]methanone |
| SMILES | C=C(C)Cc1cc(C(=O)N2CCN(CC(C)C)CC2)ccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C26H33FN2O2/c1-19(2)15-23-16-22(26(30)29-13-11-28(12-14-29)17-20(3)4)7-10-25(23)31-18-21-5-8-24(27)9-6-21/h5-10,16,20H,1,11-15,17-18H2,2-4H3 |
| InChIKey | REUNYMJVVGIOHH-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|