About hexadecyl 2-oxoacetate
hexadecyl 2-oxoacetate (PubChem CID 18914773) has the molecular formula C18H34O3
and a molecular weight of 298.47 g/mol. Its IUPAC name is hexadecyl 2-oxoacetate.
Molecular Properties
| Compound Name | hexadecyl 2-oxoacetate |
| PubChem CID | 18914773 |
| Molecular Formula | C18H34O3 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.25 |
| IUPAC Name | hexadecyl 2-oxoacetate |
| SMILES | CCCCCCCCCCCCCCCCOC(=O)C=O |
| InChI | InChI=1S/C18H34O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-21-18(20)17-19/h17H,2-16H2,1H3 |
| InChIKey | GISMBTSFEGXOBT-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze hexadecyl 2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexadecyl 2-oxoacetate?
The IUPAC name of hexadecyl 2-oxoacetate (CID 18914773) is hexadecyl 2-oxoacetate.
What is the SMILES notation for hexadecyl 2-oxoacetate?
The canonical SMILES for hexadecyl 2-oxoacetate is CCCCCCCCCCCCCCCCOC(=O)C=O.
What is the InChIKey of hexadecyl 2-oxoacetate?
The InChIKey is GISMBTSFEGXOBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-21-18(20)17-19/h17H,2-16H2,1H3.
What are the key properties of hexadecyl 2-oxoacetate?
hexadecyl 2-oxoacetate has a molecular weight of 298.47 g/mol, XLogP of 5.21, 16 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexadecyl 2-oxoacetate is sourced from PubChem (CID 18914773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).