About 6-oxo-4,5-dihydrocyclopenta[b]thiophene-4-carbonyl chloride
6-oxo-4,5-dihydrocyclopenta[b]thiophene-4-carbonyl chloride (PubChem CID 18915019) has the molecular formula C8H5ClO2S
and a molecular weight of 200.65 g/mol. Its IUPAC name is 6-oxo-4,5-dihydrocyclopenta[b]thiophene-4-carbonyl chloride.
Molecular Properties
| Compound Name | 6-oxo-4,5-dihydrocyclopenta[b]thiophene-4-carbonyl chloride |
| PubChem CID | 18915019 |
| Molecular Formula | C8H5ClO2S |
| Molecular Weight | 200.65 g/mol |
| Exact Mass | 199.97 |
| IUPAC Name | 6-oxo-4,5-dihydrocyclopenta[b]thiophene-4-carbonyl chloride |
| SMILES | O=C1CC(C(=O)Cl)c2ccsc21 |
| InChI | InChI=1S/C8H5ClO2S/c9-8(11)5-3-6(10)7-4(5)1-2-12-7/h1-2,5H,3H2 |
| InChIKey | RZFFTLFTOQZKRR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.65 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-oxo-4,5-dihydrocyclopenta[b]thiophene-4-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxo-4,5-dihydrocyclopenta[b]thiophene-4-carbonyl chloride?
The IUPAC name of 6-oxo-4,5-dihydrocyclopenta[b]thiophene-4-carbonyl chloride (CID 18915019) is 6-oxo-4,5-dihydrocyclopenta[b]thiophene-4-carbonyl chloride.
What is the SMILES notation for 6-oxo-4,5-dihydrocyclopenta[b]thiophene-4-carbonyl chloride?
The canonical SMILES for 6-oxo-4,5-dihydrocyclopenta[b]thiophene-4-carbonyl chloride is O=C1CC(C(=O)Cl)c2ccsc21.
What is the InChIKey of 6-oxo-4,5-dihydrocyclopenta[b]thiophene-4-carbonyl chloride?
The InChIKey is RZFFTLFTOQZKRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClO2S/c9-8(11)5-3-6(10)7-4(5)1-2-12-7/h1-2,5H,3H2.
What are the key properties of 6-oxo-4,5-dihydrocyclopenta[b]thiophene-4-carbonyl chloride?
6-oxo-4,5-dihydrocyclopenta[b]thiophene-4-carbonyl chloride has a molecular weight of 200.65 g/mol, XLogP of 2.18, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxo-4,5-dihydrocyclopenta[b]thiophene-4-carbonyl chloride is sourced from PubChem (CID 18915019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).